C38H52IrNO2- — CID 170528122
7-cyclopentyl-2-phenylquinoline;iridium;2,2,7,7-tetraethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol (PubChem CID 170528122) has the molecular formula C38H52IrNO2- and a molecular weight of 747.06 g/mol. Its IUPAC name is 7-cyclopentyl-2-phenylquinoline;iridium;2,2,7,7-tetraethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol.
| Compound Name | 7-cyclopentyl-2-phenylquinoline;iridium;2,2,7,7-tetraethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 170528122 |
| Molecular Formula | C38H52IrNO2- |
| Molecular Weight | 747.06 g/mol |
| Exact Mass | 747.36 |
| IUPAC Name | 7-cyclopentyl-2-phenylquinoline;iridium;2,2,7,7-tetraethyl-1,3,3a,4,5,6,8,8a-octahydroazulene-1,8-diol |
| SMILES | CCC1(CC)CCCC2CC(CC)(CC)C(O)C2C1O.[Ir].[c-]1ccccc1-c1ccc2ccc(C3CCCC3)cc2n1 |
| InChI | InChI=1S/C20H18N.C18H34O2.Ir/c1-2-8-16(9-3-1)19-13-12-17-10-11-18(14-20(17)21-19)15-6-4-5-7-15;1-5-17(6-2)11-9-10-13-12-18(7-3,8-4)16(20)14(13)15(17)19;/h1-3,8,10-15H,4-7H2;13-16,19-20H,5-12H2,1-4H3;/q-1;; |
| InChIKey | WJMJHCSZZHKQEK-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.06 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|