C33H44IrNO2- — CID 170527397
2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;iridium;2,2,9,9-tetramethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol (PubChem CID 170527397) has the molecular formula C33H44IrNO2- and a molecular weight of 678.94 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;iridium;2,2,9,9-tetramethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;iridium;2,2,9,9-tetramethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol |
|---|---|
| PubChem CID | 170527397 |
| Molecular Formula | C33H44IrNO2- |
| Molecular Weight | 678.94 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;iridium;2,2,9,9-tetramethyl-1,3,4,5,5a,6,7,8,10,10a-decahydroheptalene-1,10-diol |
| SMILES | CC1(C)CCCC2CCCC(C)(C)C(O)C2C1O.Cc1[c-]c(-c2ccc3ccccc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C17H14N.C16H30O2.Ir/c1-12-9-13(2)11-15(10-12)17-8-7-14-5-3-4-6-16(14)18-17;1-15(2)9-5-7-11-8-6-10-16(3,4)14(18)12(11)13(15)17;/h3-10H,1-2H3;11-14,17-18H,5-10H2,1-4H3;/q-1;; |
| InChIKey | GZUXKOCUSSIGPA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.94 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|