C28H30IrNO2- — CID 170527246
2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium (PubChem CID 170527246) has the molecular formula C28H30IrNO2- and a molecular weight of 604.77 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium |
|---|---|
| PubChem CID | 170527246 |
| Molecular Formula | C28H30IrNO2- |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;8-hydroxy-3,4,4a,5,6,7-hexahydro-2H-naphthalen-1-one;iridium |
| SMILES | Cc1[c-]c(-c2ccc3c(C)cccc3n2)cc(C)c1.O=C1CCCC2CCCC(O)=C12.[Ir] |
| InChI | InChI=1S/C18H16N.C10H14O2.Ir/c1-12-9-13(2)11-15(10-12)17-8-7-16-14(3)5-4-6-18(16)19-17;11-8-5-1-3-7-4-2-6-9(12)10(7)8;/h4-10H,1-3H3;7,11H,1-6H2;/q-1;; |
| InChIKey | CTTBIVQJCKLWSI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|