C24H30IrNO2- — CID 164944944
2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;iridium;2-methylpentane-2,4-diol (PubChem CID 164944944) has the molecular formula C24H30IrNO2- and a molecular weight of 556.73 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;iridium;2-methylpentane-2,4-diol.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;iridium;2-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 164944944 |
| Molecular Formula | C24H30IrNO2- |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-methylquinoline;iridium;2-methylpentane-2,4-diol |
| SMILES | CC(O)CC(C)(C)O.Cc1[c-]c(-c2ccc3c(C)cccc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C18H16N.C6H14O2.Ir/c1-12-9-13(2)11-15(10-12)17-8-7-16-14(3)5-4-6-18(16)19-17;1-5(7)4-6(2,3)8;/h4-10H,1-3H3;5,7-8H,4H2,1-3H3;/q-1;; |
| InChIKey | YAHSFNKXKDJERU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|