C39H36IrNOP-2 — CID 164702240
2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2-methylpropyl)quinoline;diphenylphosphorylbenzene;iridium (PubChem CID 164702240) has the molecular formula C39H36IrNOP-2 and a molecular weight of 757.91 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2-methylpropyl)quinoline;diphenylphosphorylbenzene;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2-methylpropyl)quinoline;diphenylphosphorylbenzene;iridium |
|---|---|
| PubChem CID | 164702240 |
| Molecular Formula | C39H36IrNOP-2 |
| Molecular Weight | 757.91 g/mol |
| Exact Mass | 758.22 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-(2-methylpropyl)quinoline;diphenylphosphorylbenzene;iridium |
| SMILES | Cc1[c-]c(-c2ccc3c(CC(C)C)cccc3n2)cc(C)c1.O=P(c1[c-]cccc1)(c1ccccc1)c1ccccc1.[Ir] |
| InChI | InChI=1S/C21H22N.C18H14OP.Ir/c1-14(2)10-17-6-5-7-21-19(17)8-9-20(22-21)18-12-15(3)11-16(4)13-18;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h5-9,11-12,14H,10H2,1-4H3;1-14H;/q2*-1; |
| InChIKey | DECJISNKBKOZQT-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.91 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|