C45H42IrNOP-2 — CID 164702280
5-(1-adamantyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;diphenylphosphorylbenzene;iridium (PubChem CID 164702280) has the molecular formula C45H42IrNOP-2 and a molecular weight of 836.03 g/mol. Its IUPAC name is 5-(1-adamantyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;diphenylphosphorylbenzene;iridium.
| Compound Name | 5-(1-adamantyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;diphenylphosphorylbenzene;iridium |
|---|---|
| PubChem CID | 164702280 |
| Molecular Formula | C45H42IrNOP-2 |
| Molecular Weight | 836.03 g/mol |
| Exact Mass | 836.26 |
| IUPAC Name | 5-(1-adamantyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;diphenylphosphorylbenzene;iridium |
| SMILES | Cc1[c-]c(-c2ccc3c(C45CC6CC(CC(C6)C4)C5)cccc3n2)cc(C)c1.O=P(c1[c-]cccc1)(c1ccccc1)c1ccccc1.[Ir] |
| InChI | InChI=1S/C27H28N.C18H14OP.Ir/c1-17-8-18(2)10-22(9-17)25-7-6-23-24(4-3-5-26(23)28-25)27-14-19-11-20(15-27)13-21(12-19)16-27;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h3-9,19-21H,11-16H2,1-2H3;1-14H;/q2*-1; |
| InChIKey | KFNXPPBRCODANI-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.03 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|