C49H56F2IrNO2Si- — CID 156675715
(Z)-1,3-bis(1-adamantyl)-3-hydroxyprop-2-en-1-one;[4-(2,6-difluorophenyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinolin-6-yl]-trimethylsilane;iridium (PubChem CID 156675715) has the molecular formula C49H56F2IrNO2Si- and a molecular weight of 949.29 g/mol. Its IUPAC name is (Z)-1,3-bis(1-adamantyl)-3-hydroxyprop-2-en-1-one;[4-(2,6-difluorophenyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinolin-6-yl]-trimethylsilane;iridium.
| Compound Name | (Z)-1,3-bis(1-adamantyl)-3-hydroxyprop-2-en-1-one;[4-(2,6-difluorophenyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinolin-6-yl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156675715 |
| Molecular Formula | C49H56F2IrNO2Si- |
| Molecular Weight | 949.29 g/mol |
| Exact Mass | 949.37 |
| IUPAC Name | (Z)-1,3-bis(1-adamantyl)-3-hydroxyprop-2-en-1-one;[4-(2,6-difluorophenyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinolin-6-yl]-trimethylsilane;iridium |
| SMILES | Cc1[c-]c(-c2cc(-c3c(F)cccc3F)c3cc([Si](C)(C)C)ccc3n2)cc(C)c1.O=C(/C=C(\O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Ir] |
| InChI | InChI=1S/C26H24F2NSi.C23H32O2.Ir/c1-16-11-17(2)13-18(12-16)25-15-21(26-22(27)7-6-8-23(26)28)20-14-19(30(3,4)5)9-10-24(20)29-25;24-20(22-8-14-1-15(9-22)3-16(2-14)10-22)7-21(25)23-11-17-4-18(12-23)6-19(5-17)13-23;/h6-12,14-15H,1-5H3;7,14-19,24H,1-6,8-13H2;/q-1;;/b;20-7-; |
| InChIKey | GLCTYMZFTXAXRH-ZORJJEQJSA-N |
| XLogP | 12.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.29 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|