C35H42IrNO2Si- — CID 156675556
[2-(3,5-dimethylbenzene-6-id-1-yl)-5-phenylquinolin-4-yl]-trimethylsilane;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 156675556) has the molecular formula C35H42IrNO2Si- and a molecular weight of 729.03 g/mol. Its IUPAC name is [2-(3,5-dimethylbenzene-6-id-1-yl)-5-phenylquinolin-4-yl]-trimethylsilane;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | [2-(3,5-dimethylbenzene-6-id-1-yl)-5-phenylquinolin-4-yl]-trimethylsilane;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 156675556 |
| Molecular Formula | C35H42IrNO2Si- |
| Molecular Weight | 729.03 g/mol |
| Exact Mass | 729.26 |
| IUPAC Name | [2-(3,5-dimethylbenzene-6-id-1-yl)-5-phenylquinolin-4-yl]-trimethylsilane;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.Cc1[c-]c(-c2cc([Si](C)(C)C)c3c(-c4ccccc4)cccc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C26H26NSi.C9H16O2.Ir/c1-18-14-19(2)16-21(15-18)24-17-25(28(3,4)5)26-22(12-9-13-23(26)27-24)20-10-7-6-8-11-20;1-6(2)8(10)5-9(11)7(3)4;/h6-15,17H,1-5H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | KLQYKTBFUGWFJP-QBBOVCHSSA-N |
| XLogP | 8.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.03 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|