C39H50IrNO2Si- — CID 156675858
[2-(3,5-dimethylbenzene-6-id-1-yl)-4-phenylquinolin-6-yl]-trimethylsilane;iridium;(Z)-3,5,7-trideuterio-3,7-diethyl-6-hydroxynon-5-en-4-one (PubChem CID 156675858) has the molecular formula C39H50IrNO2Si- and a molecular weight of 788.16 g/mol. Its IUPAC name is [2-(3,5-dimethylbenzene-6-id-1-yl)-4-phenylquinolin-6-yl]-trimethylsilane;iridium;(Z)-3,5,7-trideuterio-3,7-diethyl-6-hydroxynon-5-en-4-one.
| Compound Name | [2-(3,5-dimethylbenzene-6-id-1-yl)-4-phenylquinolin-6-yl]-trimethylsilane;iridium;(Z)-3,5,7-trideuterio-3,7-diethyl-6-hydroxynon-5-en-4-one |
|---|---|
| PubChem CID | 156675858 |
| Molecular Formula | C39H50IrNO2Si- |
| Molecular Weight | 788.16 g/mol |
| Exact Mass | 788.34 |
| IUPAC Name | [2-(3,5-dimethylbenzene-6-id-1-yl)-4-phenylquinolin-6-yl]-trimethylsilane;iridium;(Z)-3,5,7-trideuterio-3,7-diethyl-6-hydroxynon-5-en-4-one |
| SMILES | Cc1[c-]c(-c2cc(-c3ccccc3)c3cc([Si](C)(C)C)ccc3n2)cc(C)c1.[2H]/C(C(=O)C([2H])(CC)CC)=C(/O)C([2H])(CC)CC.[Ir] |
| InChI | InChI=1S/C26H26NSi.C13H24O2.Ir/c1-18-13-19(2)15-21(14-18)26-17-23(20-9-7-6-8-10-20)24-16-22(28(3,4)5)11-12-25(24)27-26;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-14,16-17H,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i;9D,10D,11D; |
| InChIKey | YHOFSBYZXNWRAT-FVTJBBPISA-N |
| XLogP | 10.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.16 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|