C39H52IrNO2Si2- — CID 156675577
[2,6-dimethyl-4-(4-phenyl-6-trimethylsilylquinolin-2-yl)benzene-5-id-1-yl]-trimethylsilane;(Z)-5-hydroxy-2,2,6-trimethylhept-4-en-3-one;iridium (PubChem CID 156675577) has the molecular formula C39H52IrNO2Si2- and a molecular weight of 815.24 g/mol. Its IUPAC name is [2,6-dimethyl-4-(4-phenyl-6-trimethylsilylquinolin-2-yl)benzene-5-id-1-yl]-trimethylsilane;(Z)-5-hydroxy-2,2,6-trimethylhept-4-en-3-one;iridium.
| Compound Name | [2,6-dimethyl-4-(4-phenyl-6-trimethylsilylquinolin-2-yl)benzene-5-id-1-yl]-trimethylsilane;(Z)-5-hydroxy-2,2,6-trimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 156675577 |
| Molecular Formula | C39H52IrNO2Si2- |
| Molecular Weight | 815.24 g/mol |
| Exact Mass | 815.32 |
| IUPAC Name | [2,6-dimethyl-4-(4-phenyl-6-trimethylsilylquinolin-2-yl)benzene-5-id-1-yl]-trimethylsilane;(Z)-5-hydroxy-2,2,6-trimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)/C(O)=C/C(=O)C(C)(C)C.Cc1[c-]c(-c2cc(-c3ccccc3)c3cc([Si](C)(C)C)ccc3n2)cc(C)c1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C29H34NSi2.C10H18O2.Ir/c1-20-16-23(17-21(2)29(20)32(6,7)8)28-19-25(22-12-10-9-11-13-22)26-18-24(31(3,4)5)14-15-27(26)30-28;1-7(2)8(11)6-9(12)10(3,4)5;/h9-16,18-19H,1-8H3;6-7,11H,1-5H3;/q-1;;/b;8-6-; |
| InChIKey | GZBFRYPOJZSOHN-QBUDOIDPSA-N |
| XLogP | 9.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.24 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|