C38H48IrNO2- — CID 153320258
(Z)-1-(1-adamantyl)-1-hydroxy-4,4-dimethylpent-1-en-3-one;6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium (PubChem CID 153320258) has the molecular formula C38H48IrNO2- and a molecular weight of 743.02 g/mol. Its IUPAC name is (Z)-1-(1-adamantyl)-1-hydroxy-4,4-dimethylpent-1-en-3-one;6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium.
| Compound Name | (Z)-1-(1-adamantyl)-1-hydroxy-4,4-dimethylpent-1-en-3-one;6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium |
|---|---|
| PubChem CID | 153320258 |
| Molecular Formula | C38H48IrNO2- |
| Molecular Weight | 743.02 g/mol |
| Exact Mass | 743.33 |
| IUPAC Name | (Z)-1-(1-adamantyl)-1-hydroxy-4,4-dimethylpent-1-en-3-one;6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C12CC3CC(CC(C3)C1)C2.CCC(C)c1ccc2c(-c3[c-]c(C)cc(C)c3)nccc2c1.[Ir] |
| InChI | InChI=1S/C21H22N.C17H26O2.Ir/c1-5-16(4)17-6-7-20-18(13-17)8-9-22-21(20)19-11-14(2)10-15(3)12-19;1-16(2,3)14(18)7-15(19)17-8-11-4-12(9-17)6-13(5-11)10-17;/h6-11,13,16H,5H2,1-4H3;7,11-13,19H,4-6,8-10H2,1-3H3;/q-1;;/b;15-7-; |
| InChIKey | PXZIKOWYCYHFAD-GISKFISRSA-N |
| XLogP | 10.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.02 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|