C35H48IrNO2- — CID 153437034
6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)-7-propan-2-ylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 153437034) has the molecular formula C35H48IrNO2- and a molecular weight of 706.99 g/mol. Its IUPAC name is 6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)-7-propan-2-ylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)-7-propan-2-ylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 153437034 |
| Molecular Formula | C35H48IrNO2- |
| Molecular Weight | 706.99 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | 6-butan-2-yl-1-(3,5-dimethylbenzene-6-id-1-yl)-7-propan-2-ylisoquinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CCC(C)c1cc2ccnc(-c3[c-]c(C)cc(C)c3)c2cc1C(C)C.[Ir] |
| InChI | InChI=1S/C24H28N.C11H20O2.Ir/c1-7-18(6)22-13-19-8-9-25-24(23(19)14-21(22)15(2)3)20-11-16(4)10-17(5)12-20;1-10(2,3)8(12)7-9(13)11(4,5)6;/h8-11,13-15,18H,7H2,1-6H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | VIIRPRXXOARJBF-HXIBTQJOSA-N |
| XLogP | 10.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.99 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|