About 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline
6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline (PubChem CID 146431923) has the molecular formula C24H29N
and a molecular weight of 331.50 g/mol. Its IUPAC name is 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline.
Molecular Properties
| Compound Name | 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline |
| PubChem CID | 146431923 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline |
| SMILES | CCC(C)c1cc2ccnc(-c3cc(C)cc(C)c3)c2cc1C(C)C |
| InChI | InChI=1S/C24H29N/c1-7-18(6)22-13-19-8-9-25-24(23(19)14-21(22)15(2)3)20-11-16(4)10-17(5)12-20/h8-15,18H,7H2,1-6H3 |
| InChIKey | APPIZAJPGOEPLY-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline?
The IUPAC name of 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline (CID 146431923) is 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline.
What is the SMILES notation for 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline?
The canonical SMILES for 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline is CCC(C)c1cc2ccnc(-c3cc(C)cc(C)c3)c2cc1C(C)C.
What is the InChIKey of 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline?
The InChIKey is APPIZAJPGOEPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N/c1-7-18(6)22-13-19-8-9-25-24(23(19)14-21(22)15(2)3)20-11-16(4)10-17(5)12-20/h8-15,18H,7H2,1-6H3.
What are the key properties of 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline?
6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline has a molecular weight of 331.50 g/mol, XLogP of 7.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinoline is sourced from PubChem (CID 146431923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).