C24H29N — CID 153437049
6-butan-2-yl-1-(3-tert-butyl-5-methylphenyl)isoquinoline (PubChem CID 153437049) has the molecular formula C24H29N and a molecular weight of 331.50 g/mol. Its IUPAC name is 6-butan-2-yl-1-(3-tert-butyl-5-methylphenyl)isoquinoline.
| Compound Name | 6-butan-2-yl-1-(3-tert-butyl-5-methylphenyl)isoquinoline |
|---|---|
| PubChem CID | 153437049 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 6-butan-2-yl-1-(3-tert-butyl-5-methylphenyl)isoquinoline |
| SMILES | CCC(C)c1ccc2c(-c3cc(C)cc(C(C)(C)C)c3)nccc2c1 |
| InChI | InChI=1S/C24H29N/c1-7-17(3)18-8-9-22-19(14-18)10-11-25-23(22)20-12-16(2)13-21(15-20)24(4,5)6/h8-15,17H,7H2,1-6H3 |
| InChIKey | CPSXAGFAHLJYON-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |