About [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane
[1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane (PubChem CID 155277503) has the molecular formula C26H35NS
and a molecular weight of 393.64 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane.
Molecular Properties
| Compound Name | [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane |
| PubChem CID | 155277503 |
| Molecular Formula | C26H35NS |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane |
| SMILES | Cc1cc(C)cc(-c2nccc3cc(S(C(C)C)(C(C)C)C(C)C)ccc23)c1 |
| InChI | InChI=1S/C26H35NS/c1-17(2)28(18(3)4,19(5)6)24-9-10-25-22(16-24)11-12-27-26(25)23-14-20(7)13-21(8)15-23/h9-19H,1-8H3 |
| InChIKey | SQFCPGJYUOHEBT-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane?
The IUPAC name of [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane (CID 155277503) is [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane.
What is the SMILES notation for [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane?
The canonical SMILES for [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane is Cc1cc(C)cc(-c2nccc3cc(S(C(C)C)(C(C)C)C(C)C)ccc23)c1.
What is the InChIKey of [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane?
The InChIKey is SQFCPGJYUOHEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35NS/c1-17(2)28(18(3)4,19(5)6)24-9-10-25-22(16-24)11-12-27-26(25)23-14-20(7)13-21(8)15-23/h9-19H,1-8H3.
What are the key properties of [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane?
[1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane has a molecular weight of 393.64 g/mol, XLogP of 7.91, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-dimethylphenyl)isoquinolin-6-yl]-tri(propan-2-yl)-λ4-sulfane is sourced from PubChem (CID 155277503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).