C23H29NSi — CID 140609491
[1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinolin-5-yl]-trimethylsilane (PubChem CID 140609491) has the molecular formula C23H29NSi and a molecular weight of 347.58 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinolin-5-yl]-trimethylsilane.
| Compound Name | [1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinolin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 140609491 |
| Molecular Formula | C23H29NSi |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [1-(3,5-dimethylphenyl)-7-propan-2-ylisoquinolin-5-yl]-trimethylsilane |
| SMILES | Cc1cc(C)cc(-c2nccc3c([Si](C)(C)C)cc(C(C)C)cc23)c1 |
| InChI | InChI=1S/C23H29NSi/c1-15(2)18-13-21-20(22(14-18)25(5,6)7)8-9-24-23(21)19-11-16(3)10-17(4)12-19/h8-15H,1-7H3 |
| InChIKey | UXKJHQGZZDLOBV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|