C24H28IrNO2- — CID 154623395
2-(3,5-dimethylbenzene-6-id-1-yl)-5-ethylquinoline;4-hydroxypentan-2-one;iridium (PubChem CID 154623395) has the molecular formula C24H28IrNO2- and a molecular weight of 554.71 g/mol. Its IUPAC name is 2-(3,5-dimethylbenzene-6-id-1-yl)-5-ethylquinoline;4-hydroxypentan-2-one;iridium.
| Compound Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-ethylquinoline;4-hydroxypentan-2-one;iridium |
|---|---|
| PubChem CID | 154623395 |
| Molecular Formula | C24H28IrNO2- |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2-(3,5-dimethylbenzene-6-id-1-yl)-5-ethylquinoline;4-hydroxypentan-2-one;iridium |
| SMILES | CC(=O)CC(C)O.CCc1cccc2nc(-c3[c-]c(C)cc(C)c3)ccc12.[Ir] |
| InChI | InChI=1S/C19H18N.C5H10O2.Ir/c1-4-15-6-5-7-19-17(15)8-9-18(20-19)16-11-13(2)10-14(3)12-16;1-4(6)3-5(2)7;/h5-11H,4H2,1-3H3;4,6H,3H2,1-2H3;/q-1;; |
| InChIKey | IMNVGPKJOOOUEZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|