C33H40IrNO2- — CID 154591164
(Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-propylquinoline;iridium (PubChem CID 154591164) has the molecular formula C33H40IrNO2- and a molecular weight of 674.91 g/mol. Its IUPAC name is (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-propylquinoline;iridium.
| Compound Name | (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-propylquinoline;iridium |
|---|---|
| PubChem CID | 154591164 |
| Molecular Formula | C33H40IrNO2- |
| Molecular Weight | 674.91 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | (Z)-1,3-dicyclopentyl-3-hydroxyprop-2-en-1-one;2-(3,5-dimethylbenzene-6-id-1-yl)-5-propylquinoline;iridium |
| SMILES | CCCc1cccc2nc(-c3[c-]c(C)cc(C)c3)ccc12.O=C(/C=C(\O)C1CCCC1)C1CCCC1.[Ir] |
| InChI | InChI=1S/C20H20N.C13H20O2.Ir/c1-4-6-16-7-5-8-20-18(16)9-10-19(21-20)17-12-14(2)11-15(3)13-17;14-12(10-5-1-2-6-10)9-13(15)11-7-3-4-8-11;/h5,7-12H,4,6H2,1-3H3;9-11,14H,1-8H2;/q-1;;/b;12-9-; |
| InChIKey | DQLRDHWFXJQEGV-DZTQYQPZSA-N |
| XLogP | 8.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.91 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|