C37H39IrN2O2- — CID 171576474
(Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-isocyanobenzo[f]isoquinoline;iridium (PubChem CID 171576474) has the molecular formula C37H39IrN2O2- and a molecular weight of 735.95 g/mol. Its IUPAC name is (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-isocyanobenzo[f]isoquinoline;iridium.
| Compound Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-isocyanobenzo[f]isoquinoline;iridium |
|---|---|
| PubChem CID | 171576474 |
| Molecular Formula | C37H39IrN2O2- |
| Molecular Weight | 735.95 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | (Z)-1,3-dicyclohexyl-3-hydroxyprop-2-en-1-one;4-(3,5-dimethylbenzene-6-id-1-yl)-8-isocyanobenzo[f]isoquinoline;iridium |
| SMILES | O=C(/C=C(\O)C1CCCCC1)C1CCCCC1.[C-]#[N+]c1ccc2c(ccc3c(-c4[c-]c(C)cc(C)c4)nccc32)c1.[Ir] |
| InChI | InChI=1S/C22H15N2.C15H24O2.Ir/c1-14-10-15(2)12-17(11-14)22-21-6-4-16-13-18(23-3)5-7-19(16)20(21)8-9-24-22;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h4-11,13H,1-2H3;11-13,16H,1-10H2;/q-1;;/b;14-11-; |
| InChIKey | BJPDCZMROZIIMQ-CKWHXWLXSA-N |
| XLogP | 10.18 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.95 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|