C37H48IrNO2- — CID 156654958
5-(2-bicyclo[2.2.1]heptanyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 156654958) has the molecular formula C37H48IrNO2- and a molecular weight of 731.01 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]heptanyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 5-(2-bicyclo[2.2.1]heptanyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 156654958 |
| Molecular Formula | C37H48IrNO2- |
| Molecular Weight | 731.01 g/mol |
| Exact Mass | 731.33 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]heptanyl)-2-(3,5-dimethylbenzene-6-id-1-yl)quinoline;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2ccc3c(C4CC5CCC4C5)cccc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C24H24N.C13H24O2.Ir/c1-15-10-16(2)12-19(11-15)23-9-8-21-20(4-3-5-24(21)25-23)22-14-17-6-7-18(22)13-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-5,8-11,17-18,22H,6-7,13-14H2,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | ZSDKOTBQZXATCE-DZTQYQPZSA-N |
| XLogP | 10.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.01 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|