C29H38IrN3O2- — CID 147424665
3,7-diethyl-6-hydroxynon-5-en-4-one;3-(3,5-dimethylbenzene-6-id-1-yl)-5-methyl-1,2,4-benzotriazine;iridium (PubChem CID 147424665) has the molecular formula C29H38IrN3O2- and a molecular weight of 652.86 g/mol. Its IUPAC name is 3,7-diethyl-6-hydroxynon-5-en-4-one;3-(3,5-dimethylbenzene-6-id-1-yl)-5-methyl-1,2,4-benzotriazine;iridium.
| Compound Name | 3,7-diethyl-6-hydroxynon-5-en-4-one;3-(3,5-dimethylbenzene-6-id-1-yl)-5-methyl-1,2,4-benzotriazine;iridium |
|---|---|
| PubChem CID | 147424665 |
| Molecular Formula | C29H38IrN3O2- |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | 3,7-diethyl-6-hydroxynon-5-en-4-one;3-(3,5-dimethylbenzene-6-id-1-yl)-5-methyl-1,2,4-benzotriazine;iridium |
| SMILES | CCC(CC)C(=O)C=C(O)C(CC)CC.Cc1[c-]c(-c2nnc3cccc(C)c3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C16H14N3.C13H24O2.Ir/c1-10-7-11(2)9-13(8-10)16-17-15-12(3)5-4-6-14(15)18-19-16;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-8H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;; |
| InChIKey | CWTTYTKLTVPEEZ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|