C48H56IrNO2P-2 — CID 164702201
1-[1-adamantyl(phenyl)phosphoryl]adamantane;2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;iridium (PubChem CID 164702201) has the molecular formula C48H56IrNO2P-2 and a molecular weight of 902.17 g/mol. Its IUPAC name is 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;iridium.
| Compound Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;iridium |
|---|---|
| PubChem CID | 164702201 |
| Molecular Formula | C48H56IrNO2P-2 |
| Molecular Weight | 902.17 g/mol |
| Exact Mass | 902.37 |
| IUPAC Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2,4-dimethyl-8-(2-methylpropyl)-1,5-dihydroisochromeno[4,3-b]quinolin-1-ide;iridium |
| SMILES | Cc1[c-]c2c(c(C)c1)COc1cc3c(CC(C)C)cccc3nc1-2.O=P(c1[c-]cccc1)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Ir] |
| InChI | InChI=1S/C26H34OP.C22H22NO.Ir/c27-28(24-4-2-1-3-5-24,25-12-18-6-19(13-25)8-20(7-18)14-25)26-15-21-9-22(16-26)11-23(10-21)17-26;1-13(2)8-16-6-5-7-20-17(16)11-21-22(23-20)18-10-14(3)9-15(4)19(18)12-24-21;/h1-4,18-23H,6-17H2;5-7,9,11,13H,8,12H2,1-4H3;/q2*-1; |
| InChIKey | OOIKMSYMKSKKCG-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.17 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|