About 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline
1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline (PubChem CID 164702262) has the molecular formula C41H44IrNOP-2
and a molecular weight of 790.00 g/mol. Its IUPAC name is 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline.
Molecular Properties
| Compound Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline |
| PubChem CID | 164702262 |
| Molecular Formula | C41H44IrNOP-2 |
| Molecular Weight | 790.00 g/mol |
| Exact Mass | 790.28 |
| IUPAC Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline |
| SMILES | O=P(c1[c-]cccc1)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C26H34OP.C15H10N.Ir/c27-28(24-4-2-1-3-5-24,25-12-18-6-19(13-25)8-20(7-18)14-25)26-15-21-9-22(16-26)11-23(10-21)17-26;1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-4,18-23H,6-17H2;1-7,9-11H;/q2*-1; |
| InChIKey | QLDSWSDPBRUWJX-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 790.00 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline?
The IUPAC name of 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline (CID 164702262) is 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline.
What is the SMILES notation for 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline?
The canonical SMILES for 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline is O=P(c1[c-]cccc1)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Ir].[c-]1ccccc1-c1nccc2ccccc12.
What is the InChIKey of 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline?
The InChIKey is QLDSWSDPBRUWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34OP.C15H10N.Ir/c27-28(24-4-2-1-3-5-24,25-12-18-6-19(13-25)8-20(7-18)14-25)26-15-21-9-22(16-26)11-23(10-21)17-26;1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h1-4,18-23H,6-17H2;1-7,9-11H;/q2*-1;.
What are the key properties of 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline?
1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline has a molecular weight of 790.00 g/mol, XLogP of 10.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-adamantyl(phenyl)phosphoryl]adamantane;iridium;1-phenylisoquinoline is sourced from PubChem (CID 164702262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).