C43H44IrNOPS-2 — CID 164702137
1-[1-adamantyl(phenyl)phosphoryl]adamantane;2-(3H-dibenzothiophen-3-id-4-yl)pyridine;iridium (PubChem CID 164702137) has the molecular formula C43H44IrNOPS-2 and a molecular weight of 846.09 g/mol. Its IUPAC name is 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2-(3H-dibenzothiophen-3-id-4-yl)pyridine;iridium.
| Compound Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2-(3H-dibenzothiophen-3-id-4-yl)pyridine;iridium |
|---|---|
| PubChem CID | 164702137 |
| Molecular Formula | C43H44IrNOPS-2 |
| Molecular Weight | 846.09 g/mol |
| Exact Mass | 846.25 |
| IUPAC Name | 1-[1-adamantyl(phenyl)phosphoryl]adamantane;2-(3H-dibenzothiophen-3-id-4-yl)pyridine;iridium |
| SMILES | O=P(c1[c-]cccc1)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Ir].[c-]1ccc2c(sc3ccccc32)c1-c1ccccn1 |
| InChI | InChI=1S/C26H34OP.C17H10NS.Ir/c27-28(24-4-2-1-3-5-24,25-12-18-6-19(13-25)8-20(7-18)14-25)26-15-21-9-22(16-26)11-23(10-21)17-26;1-2-10-16-12(6-1)13-7-5-8-14(17(13)19-16)15-9-3-4-11-18-15;/h1-4,18-23H,6-17H2;1-7,9-11H;/q2*-1; |
| InChIKey | WMWLRVOJXLPXJQ-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.09 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|