C35H24IrNO2P-2 — CID 164702147
2-(3H-dibenzofuran-3-id-4-yl)pyridine;diphenylphosphorylbenzene;iridium (PubChem CID 164702147) has the molecular formula C35H24IrNO2P-2 and a molecular weight of 713.77 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)pyridine;diphenylphosphorylbenzene;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)pyridine;diphenylphosphorylbenzene;iridium |
|---|---|
| PubChem CID | 164702147 |
| Molecular Formula | C35H24IrNO2P-2 |
| Molecular Weight | 713.77 g/mol |
| Exact Mass | 714.12 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)pyridine;diphenylphosphorylbenzene;iridium |
| SMILES | O=P(c1[c-]cccc1)(c1ccccc1)c1ccccc1.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1ccccn1 |
| InChI | InChI=1S/C18H14OP.C17H10NO.Ir/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-10-16-12(6-1)13-7-5-8-14(17(13)19-16)15-9-3-4-11-18-15;/h1-14H;1-7,9-11H;/q2*-1; |
| InChIKey | BDMYJGXGCKVZDH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.77 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|