C47H30IrNO2P-2 — CID 164702145
2-(3H-dibenzofuran-3-id-4-yl)pyridine;3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium (PubChem CID 164702145) has the molecular formula C47H30IrNO2P-2 and a molecular weight of 863.95 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)pyridine;3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)pyridine;3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium |
|---|---|
| PubChem CID | 164702145 |
| Molecular Formula | C47H30IrNO2P-2 |
| Molecular Weight | 863.95 g/mol |
| Exact Mass | 864.17 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)pyridine;3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium |
| SMILES | O=P(c1[c-]cc2ccccc2c1)(c1ccc2ccccc2c1)c1ccc2ccccc2c1.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1ccccn1 |
| InChI | InChI=1S/C30H20OP.C17H10NO.Ir/c31-32(28-16-13-22-7-1-4-10-25(22)19-28,29-17-14-23-8-2-5-11-26(23)20-29)30-18-15-24-9-3-6-12-27(24)21-30;1-2-10-16-12(6-1)13-7-5-8-14(17(13)19-16)15-9-3-4-11-18-15;/h1-17,19-21H;1-7,9-11H;/q2*-1; |
| InChIKey | ULWZGUFAPUSHFX-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.95 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|