C54H39IrN2O2P-2 — CID 164702200
3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-methyl-8-(6-propan-2-ylisoquinolin-1-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 164702200) has the molecular formula C54H39IrN2O2P-2 and a molecular weight of 971.11 g/mol. Its IUPAC name is 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-methyl-8-(6-propan-2-ylisoquinolin-1-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-methyl-8-(6-propan-2-ylisoquinolin-1-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 164702200 |
| Molecular Formula | C54H39IrN2O2P-2 |
| Molecular Weight | 971.11 g/mol |
| Exact Mass | 971.24 |
| IUPAC Name | 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-methyl-8-(6-propan-2-ylisoquinolin-1-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | Cc1ccc2c(n1)oc1c(-c3nccc4cc(C(C)C)ccc34)[c-]ccc12.O=P(c1[c-]cc2ccccc2c1)(c1ccc2ccccc2c1)c1ccc2ccccc2c1.[Ir] |
| InChI | InChI=1S/C30H20OP.C24H19N2O.Ir/c31-32(28-16-13-22-7-1-4-10-25(22)19-28,29-17-14-23-8-2-5-11-26(23)20-29)30-18-15-24-9-3-6-12-27(24)21-30;1-14(2)16-8-10-18-17(13-16)11-12-25-22(18)21-6-4-5-19-20-9-7-15(3)26-24(20)27-23(19)21;/h1-17,19-21H;4-5,7-14H,1-3H3;/q2*-1; |
| InChIKey | AIGPUSCCCKQRBQ-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.11 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|