C38H44IrNO3- — CID 166026566
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(7-methyl-3H-dibenzofuran-3-id-4-yl)-6-propan-2-ylisoquinoline (PubChem CID 166026566) has the molecular formula C38H44IrNO3- and a molecular weight of 754.99 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(7-methyl-3H-dibenzofuran-3-id-4-yl)-6-propan-2-ylisoquinoline.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(7-methyl-3H-dibenzofuran-3-id-4-yl)-6-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 166026566 |
| Molecular Formula | C38H44IrNO3- |
| Molecular Weight | 754.99 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(7-methyl-3H-dibenzofuran-3-id-4-yl)-6-propan-2-ylisoquinoline |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2c(c1)oc1c(-c3nccc4cc(C(C)C)ccc34)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C25H20NO.C13H24O2.Ir/c1-15(2)17-8-10-19-18(14-17)11-12-26-24(19)22-6-4-5-21-20-9-7-16(3)13-23(20)27-25(21)22;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-5,7-15H,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | JGKHDNPBINVASG-DZTQYQPZSA-N |
| XLogP | 10.90 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.99 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|