C33H37IrN2O3S- — CID 168829000
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-8-(2-methylthieno[3,2-c]pyridin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide (PubChem CID 168829000) has the molecular formula C33H37IrN2O3S- and a molecular weight of 733.95 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-8-(2-methylthieno[3,2-c]pyridin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-8-(2-methylthieno[3,2-c]pyridin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
|---|---|
| PubChem CID | 168829000 |
| Molecular Formula | C33H37IrN2O3S- |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;2-methyl-8-(2-methylthieno[3,2-c]pyridin-4-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2c(n1)oc1c(-c3nccc4sc(C)cc34)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C20H13N2OS.C13H24O2.Ir/c1-11-6-7-14-13-4-3-5-15(19(13)23-20(14)22-11)18-16-10-12(2)24-17(16)8-9-21-18;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-4,6-10H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | USRGHSKNCKRXQS-DZTQYQPZSA-N |
| XLogP | 9.54 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|