C42H49IrN2O3S2- — CID 165168035
CID 165168035 (PubChem CID 165168035) has the molecular formula C42H49IrN2O3S2- and a molecular weight of 886.22 g/mol.
| Compound Name | CID 165168035 |
|---|---|
| PubChem CID | 165168035 |
| Molecular Formula | C42H49IrN2O3S2- |
| Molecular Weight | 886.22 g/mol |
| Exact Mass | 886.28 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2c(n1)oc1c2[c-]c(-c2cc(-c3ccc(CC(C)(C)C)s3)ccn2)c2sc(C)cc21.[Ir] |
| InChI | InChI=1S/C29H25N2OS2.C13H24O2.Ir/c1-16-6-8-20-21-14-22(27-23(12-17(2)33-27)26(21)32-28(20)31-16)24-13-18(10-11-30-24)25-9-7-19(34-25)15-29(3,4)5;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h6-13H,15H2,1-5H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | OTWXVBUWPRKNOV-DZTQYQPZSA-N |
| XLogP | 12.86 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.22 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|