C37H45IrN2O3S- — CID 168828681
8-[3-(1,1-dideuterio-2,2-dimethylpropyl)thieno[2,3-c]pyridin-5-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 168828681) has the molecular formula C37H45IrN2O3S- and a molecular weight of 792.07 g/mol. Its IUPAC name is 8-[3-(1,1-dideuterio-2,2-dimethylpropyl)thieno[2,3-c]pyridin-5-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 8-[3-(1,1-dideuterio-2,2-dimethylpropyl)thieno[2,3-c]pyridin-5-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 168828681 |
| Molecular Formula | C37H45IrN2O3S- |
| Molecular Weight | 792.07 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | 8-[3-(1,1-dideuterio-2,2-dimethylpropyl)thieno[2,3-c]pyridin-5-yl]-2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[2H]C([2H])(c1csc2cnc(-c3[c-]ccc4c3oc3nc(C)ccc34)cc12)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C24H21N2OS.C13H24O2.Ir/c1-14-8-9-17-16-6-5-7-18(22(16)27-23(17)26-14)20-10-19-15(11-24(2,3)4)13-28-21(19)12-25-20;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h5-6,8-10,12-13H,11H2,1-4H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;/i11D2;; |
| InChIKey | ZYIRVKLDXKTHPT-WWVLOLOGSA-N |
| XLogP | 10.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.07 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|