C41H28IrNOP-2 — CID 164702155
3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-phenylpyridine (PubChem CID 164702155) has the molecular formula C41H28IrNOP-2 and a molecular weight of 773.87 g/mol. Its IUPAC name is 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-phenylpyridine.
| Compound Name | 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164702155 |
| Molecular Formula | C41H28IrNOP-2 |
| Molecular Weight | 773.87 g/mol |
| Exact Mass | 774.15 |
| IUPAC Name | 3-dinaphthalen-2-ylphosphoryl-2H-naphthalen-2-ide;iridium;2-phenylpyridine |
| SMILES | O=P(c1[c-]cc2ccccc2c1)(c1ccc2ccccc2c1)c1ccc2ccccc2c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H20OP.C11H8N.Ir/c31-32(28-16-13-22-7-1-4-10-25(22)19-28,29-17-14-23-8-2-5-11-26(23)20-29)30-18-15-24-9-3-6-12-27(24)21-30;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-17,19-21H;1-6,8-9H;/q2*-1; |
| InChIKey | NMDAIMHRGFTFQB-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.87 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|