C43H32IrN2S-2 — CID 162708577
2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenylpyridine (PubChem CID 162708577) has the molecular formula C43H32IrN2S-2 and a molecular weight of 801.03 g/mol. Its IUPAC name is 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenylpyridine.
| Compound Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 162708577 |
| Molecular Formula | C43H32IrN2S-2 |
| Molecular Weight | 801.03 g/mol |
| Exact Mass | 801.19 |
| IUPAC Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenylpyridine |
| SMILES | CC(C)(c1ccccc1)c1ccc(-c2[c-]ccc3c2sc2ccccc23)nc1.[Ir].[c-]1ccccc1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C26H20NS.C17H12N.Ir/c1-26(2,18-9-4-3-5-10-18)19-15-16-23(27-17-19)22-13-8-12-21-20-11-6-7-14-24(20)28-25(21)22;1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15;/h3-12,14-17H,1-2H3;1-9,11-13H;/q2*-1; |
| InChIKey | QTXZXQDYFYKTML-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.03 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|