C44H34IrN2S-2 — CID 162709310
2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 162709310) has the molecular formula C44H34IrN2S-2 and a molecular weight of 818.07 g/mol. Its IUPAC name is 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162709310 |
| Molecular Formula | C44H34IrN2S-2 |
| Molecular Weight | 818.07 g/mol |
| Exact Mass | 818.23 |
| IUPAC Name | 2-(3H-dibenzothiophen-3-id-4-yl)-5-(2-phenylpropan-2-yl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | CC(C)(c1ccccc1)c1ccc(-c2[c-]ccc3c2sc2ccccc23)nc1.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C26H20NS.C18H14N.Ir/c1-26(2,18-9-4-3-5-10-18)19-15-16-23(27-17-19)22-13-8-12-21-20-11-6-7-14-24(20)28-25(21)22;1-14-13-19-18(16-10-6-3-7-11-16)12-17(14)15-8-4-2-5-9-15;/h3-12,14-17H,1-2H3;2-10,12-13H,1H3;/q2*-1;/i;1D3; |
| InChIKey | OYXOAFCFLUYHDT-ICMJTWPQSA-N |
| XLogP | 11.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.07 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|