C26H30IrN- — CID 170655069
4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium (PubChem CID 170655069) has the molecular formula C26H30IrN- and a molecular weight of 551.77 g/mol. Its IUPAC name is 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium.
| Compound Name | 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium |
|---|---|
| PubChem CID | 170655069 |
| Molecular Formula | C26H30IrN- |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1.[Ir] |
| InChI | InChI=1S/C26H30N.Ir/c1-18-17-27-24(19-11-9-8-10-12-19)16-23(18)20-13-21(25(2,3)4)15-22(14-20)26(5,6)7;/h8-11,13-17H,1-7H3;/q-1;/i1D3; |
| InChIKey | MEMCSICQILMYSW-NIIDSAIPSA-N |
| XLogP | 7.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|