C41H40IrN2Si-2 — CID 162707675
iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine;trimethyl-[6-[3-phenyl-4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane (PubChem CID 162707675) has the molecular formula C41H40IrN2Si-2 and a molecular weight of 784.11 g/mol. Its IUPAC name is iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine;trimethyl-[6-[3-phenyl-4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane.
| Compound Name | iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine;trimethyl-[6-[3-phenyl-4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
|---|---|
| PubChem CID | 162707675 |
| Molecular Formula | C41H40IrN2Si-2 |
| Molecular Weight | 784.11 g/mol |
| Exact Mass | 784.28 |
| IUPAC Name | iridium;2-phenyl-4-(2-phenylpropan-2-yl)pyridine;trimethyl-[6-[3-phenyl-4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
| SMILES | CC(C)(c1ccccc1)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1c[c-]c(-c2ccc([Si](C)(C)C)cn2)cc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C21H22NSi.C20H18N.Ir/c1-16-10-11-18(14-20(16)17-8-6-5-7-9-17)21-13-12-19(15-22-21)23(2,3)4;1-20(2,17-11-7-4-8-12-17)18-13-14-21-19(15-18)16-9-5-3-6-10-16;/h5-10,12-15H,1-4H3;3-9,11-15H,1-2H3;/q2*-1;/i1D3;; |
| InChIKey | OBRNRXLNFXBTCA-GXXYEPOPSA-N |
| XLogP | 9.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.11 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|