C37H38IrN2-2 — CID 169017950
4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;2-phenylpyridine (PubChem CID 169017950) has the molecular formula C37H38IrN2-2 and a molecular weight of 705.96 g/mol. Its IUPAC name is 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 169017950 |
| Molecular Formula | C37H38IrN2-2 |
| Molecular Weight | 705.96 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | 4-(3,5-ditert-butylphenyl)-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H30N.C11H8N.Ir/c1-18-17-27-24(19-11-9-8-10-12-19)16-23(18)20-13-21(25(2,3)4)15-22(14-20)26(5,6)7;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h8-11,13-17H,1-7H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | LEJSWIRCVSCWRJ-GXXYEPOPSA-N |
| XLogP | 9.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.96 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|