C36H39IrN2OP-2 — CID 164702277
dicyclohexylphosphorylbenzene;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide (PubChem CID 164702277) has the molecular formula C36H39IrN2OP-2 and a molecular weight of 738.91 g/mol. Its IUPAC name is dicyclohexylphosphorylbenzene;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide.
| Compound Name | dicyclohexylphosphorylbenzene;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide |
|---|---|
| PubChem CID | 164702277 |
| Molecular Formula | C36H39IrN2OP-2 |
| Molecular Weight | 738.91 g/mol |
| Exact Mass | 739.24 |
| IUPAC Name | dicyclohexylphosphorylbenzene;iridium;9-methyl-1-pyridin-2-yl-2H-carbazol-2-ide |
| SMILES | Cn1c2ccccc2c2cc[c-]c(-c3ccccn3)c21.O=P(c1[c-]cccc1)(C1CCCCC1)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C18H13N2.C18H26OP.Ir/c1-20-17-11-3-2-7-13(17)14-8-6-9-15(18(14)20)16-10-4-5-12-19-16;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2-8,10-12H,1H3;1,4-5,10,17-18H,2-3,6-9,12-15H2;/q2*-1; |
| InChIKey | APHGGDLSNMMIPI-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.91 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|