C45H46IrNOP-2 — CID 164702290
CID 164702290 (PubChem CID 164702290) has the molecular formula C45H46IrNOP-2 and a molecular weight of 840.06 g/mol.
| Compound Name | CID 164702290 |
|---|---|
| PubChem CID | 164702290 |
| Molecular Formula | C45H46IrNOP-2 |
| Molecular Weight | 840.06 g/mol |
| Exact Mass | 840.30 |
| IUPAC Name | — |
| SMILES | CC12c3c[c-]c(-c4ccccn4)cc3C(C)(c3ccccc31)c1ccccc12.O=P(c1[c-]cccc1)(C1CCCCC1)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C27H20N.C18H26OP.Ir/c1-26-19-9-3-5-11-21(19)27(2,22-12-6-4-10-20(22)26)24-17-18(14-15-23(24)26)25-13-7-8-16-28-25;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h3-13,15-17H,1-2H3;1,4-5,10,17-18H,2-3,6-9,12-15H2;/q2*-1; |
| InChIKey | BSAALSQTMWWSBQ-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.06 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|