C37H36IrN2OSi-2 — CID 155608565
5-cyclohexyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzofuran-7-id-4-yl)silane (PubChem CID 155608565) has the molecular formula C37H36IrN2OSi-2 and a molecular weight of 745.01 g/mol. Its IUPAC name is 5-cyclohexyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzofuran-7-id-4-yl)silane.
| Compound Name | 5-cyclohexyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzofuran-7-id-4-yl)silane |
|---|---|
| PubChem CID | 155608565 |
| Molecular Formula | C37H36IrN2OSi-2 |
| Molecular Weight | 745.01 g/mol |
| Exact Mass | 745.22 |
| IUPAC Name | 5-cyclohexyl-2-phenylpyridine;iridium;trimethyl-(6-pyridin-2-yl-7H-dibenzofuran-7-id-4-yl)silane |
| SMILES | C[Si](C)(C)c1cccc2c1oc1c(-c3ccccn3)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccc(C2CCCCC2)cn1 |
| InChI | InChI=1S/C20H18NOSi.C17H18N.Ir/c1-23(2,3)18-12-7-9-15-14-8-6-10-16(19(14)22-20(15)18)17-11-4-5-13-21-17;1-3-7-14(8-4-1)16-11-12-17(18-13-16)15-9-5-2-6-10-15;/h4-9,11-13H,1-3H3;2,5-6,9,11-14H,1,3-4,7-8H2;/q2*-1; |
| InChIKey | MSFYFKOYDPNHPG-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.01 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|