C45H39IrN3O-2 — CID 166037578
5-tert-butyl-2-phenylpyridine;3-(4-cyclohexylphenyl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-4-carbonitrile;iridium (PubChem CID 166037578) has the molecular formula C45H39IrN3O-2 and a molecular weight of 830.04 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;3-(4-cyclohexylphenyl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-4-carbonitrile;iridium.
| Compound Name | 5-tert-butyl-2-phenylpyridine;3-(4-cyclohexylphenyl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-4-carbonitrile;iridium |
|---|---|
| PubChem CID | 166037578 |
| Molecular Formula | C45H39IrN3O-2 |
| Molecular Weight | 830.04 g/mol |
| Exact Mass | 830.27 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;3-(4-cyclohexylphenyl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-4-carbonitrile;iridium |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.N#Cc1c(-c2ccc(C3CCCCC3)cc2)ccc2c1oc1c(-c3ccccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C30H23N2O.C15H16N.Ir/c31-19-27-23(22-14-12-21(13-15-22)20-7-2-1-3-8-20)16-17-25-24-9-6-10-26(29(24)33-30(25)27)28-11-4-5-18-32-28;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h4-6,9,11-18,20H,1-3,7-8H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | FYQCXMHTKJTWDS-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.04 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|