C53H48IrN4O-2 — CID 168774663
5-tert-butyl-2-phenylpyridine;4-(3,6-ditert-butylcarbazol-9-yl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium (PubChem CID 168774663) has the molecular formula C53H48IrN4O-2 and a molecular weight of 949.21 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;4-(3,6-ditert-butylcarbazol-9-yl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium.
| Compound Name | 5-tert-butyl-2-phenylpyridine;4-(3,6-ditert-butylcarbazol-9-yl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium |
|---|---|
| PubChem CID | 168774663 |
| Molecular Formula | C53H48IrN4O-2 |
| Molecular Weight | 949.21 g/mol |
| Exact Mass | 949.35 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;4-(3,6-ditert-butylcarbazol-9-yl)-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1c(C#N)ccc2c1oc1c(-c3ccccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C38H32N3O.C15H16N.Ir/c1-37(2,3)24-14-17-32-29(20-24)30-21-25(38(4,5)6)15-18-33(30)41(32)34-23(22-39)13-16-27-26-10-9-11-28(35(26)42-36(27)34)31-12-7-8-19-40-31;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h7-10,12-21H,1-6H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | VVWZYVKVKLWOQB-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.21 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|