C41H33IrN3O-2 — CID 169282640
6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;5-tert-butyl-2-phenylpyridine;iridium (PubChem CID 169282640) has the molecular formula C41H33IrN3O-2 and a molecular weight of 781.99 g/mol. Its IUPAC name is 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;5-tert-butyl-2-phenylpyridine;iridium.
| Compound Name | 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;5-tert-butyl-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 169282640 |
| Molecular Formula | C41H33IrN3O-2 |
| Molecular Weight | 781.99 g/mol |
| Exact Mass | 782.26 |
| IUPAC Name | 6-[4,5-bis(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;5-tert-butyl-2-phenylpyridine;iridium |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c(-c4ccccc4)c(C#N)ccc23)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C26H17N2O.C15H16N.Ir/c1-16-13-23(28-15-17(16)2)22-10-6-9-20-21-12-11-19(14-27)24(26(21)29-25(20)22)18-7-4-3-5-8-18;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h3-9,11-13,15H,1-2H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3,2D3;; |
| InChIKey | ZTFMHQMJHUBTPO-ADBWCSELSA-N |
| XLogP | 10.45 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.99 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|