C43H39IrN3OSi-2 — CID 172542755
iridium;6-[4-[methyl-di(propan-2-yl)silyl]-5-(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine (PubChem CID 172542755) has the molecular formula C43H39IrN3OSi-2 and a molecular weight of 837.13 g/mol. Its IUPAC name is iridium;6-[4-[methyl-di(propan-2-yl)silyl]-5-(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine.
| Compound Name | iridium;6-[4-[methyl-di(propan-2-yl)silyl]-5-(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine |
|---|---|
| PubChem CID | 172542755 |
| Molecular Formula | C43H39IrN3OSi-2 |
| Molecular Weight | 837.13 g/mol |
| Exact Mass | 837.27 |
| IUPAC Name | iridium;6-[4-[methyl-di(propan-2-yl)silyl]-5-(trideuteriomethyl)-2-pyridinyl]-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;2-phenylpyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c(-c4ccccc4)c(C#N)ccc23)cc1[Si](C)(C(C)C)C(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C32H31N2OSi.C11H8N.Ir/c1-20(2)36(6,21(3)4)29-17-28(34-19-22(29)5)27-14-10-13-25-26-16-15-24(18-33)30(32(26)35-31(25)27)23-11-8-7-9-12-23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h7-13,15-17,19-21H,1-6H3;1-6,8-9H;/q2*-1;/i5D3;; |
| InChIKey | PFVXTHYOOVXGGP-YLSPSJLGSA-N |
| XLogP | 10.95 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.13 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|