C45H33IrN3O-2 — CID 167365946
5-tert-butyl-2-phenylpyridine;iridium;6-pyridin-2-yl-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7H-dibenzofuran-7-ide-3-carbonitrile (PubChem CID 167365946) has the molecular formula C45H33IrN3O-2 and a molecular weight of 833.05 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;iridium;6-pyridin-2-yl-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7H-dibenzofuran-7-ide-3-carbonitrile.
| Compound Name | 5-tert-butyl-2-phenylpyridine;iridium;6-pyridin-2-yl-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7H-dibenzofuran-7-ide-3-carbonitrile |
|---|---|
| PubChem CID | 167365946 |
| Molecular Formula | C45H33IrN3O-2 |
| Molecular Weight | 833.05 g/mol |
| Exact Mass | 833.28 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;iridium;6-pyridin-2-yl-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-7H-dibenzofuran-7-ide-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3c(C#N)ccc4c3oc3c(-c5ccccn5)[c-]ccc34)c([2H])c2[2H])c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C30H17N2O.C15H16N.Ir/c31-19-23-16-17-25-24-9-6-10-26(27-11-4-5-18-32-27)29(24)33-30(25)28(23)22-14-12-21(13-15-22)20-7-2-1-3-8-20;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-9,11-18H;4-7,9-11H,1-3H3;/q2*-1;/i1D,2D,3D,7D,8D,12D,13D,14D,15D;; |
| InChIKey | JYRDZOUDYITYPB-CWSWYEEPSA-N |
| XLogP | 11.50 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.05 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|