C47H33IrN3O-2 — CID 169077041
5-tert-butyl-2-phenylpyridine;iridium;4-phenanthren-2-yl-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile (PubChem CID 169077041) has the molecular formula C47H33IrN3O-2 and a molecular weight of 848.02 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;iridium;4-phenanthren-2-yl-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile.
| Compound Name | 5-tert-butyl-2-phenylpyridine;iridium;4-phenanthren-2-yl-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile |
|---|---|
| PubChem CID | 169077041 |
| Molecular Formula | C47H33IrN3O-2 |
| Molecular Weight | 848.02 g/mol |
| Exact Mass | 848.23 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;iridium;4-phenanthren-2-yl-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.N#Cc1ccc2c(oc3c(-c4ccccn4)[c-]ccc32)c1-c1ccc2c(ccc3ccccc32)c1.[Ir] |
| InChI | InChI=1S/C32H17N2O.C15H16N.Ir/c33-19-23-14-16-27-26-8-5-9-28(29-10-3-4-17-34-29)31(26)35-32(27)30(23)22-13-15-25-21(18-22)12-11-20-6-1-2-7-24(20)25;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-8,10-18H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | OITZYMCQLKYXTI-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.02 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|