C48H31IrN3O-2 — CID 165386049
iridium;5-methyl-2-phenylpyridine;4-[3-(4-phenylphenyl)phenyl]-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile (PubChem CID 165386049) has the molecular formula C48H31IrN3O-2 and a molecular weight of 858.01 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;4-[3-(4-phenylphenyl)phenyl]-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile.
| Compound Name | iridium;5-methyl-2-phenylpyridine;4-[3-(4-phenylphenyl)phenyl]-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile |
|---|---|
| PubChem CID | 165386049 |
| Molecular Formula | C48H31IrN3O-2 |
| Molecular Weight | 858.01 g/mol |
| Exact Mass | 858.21 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;4-[3-(4-phenylphenyl)phenyl]-6-pyridin-2-yl-7H-dibenzofuran-7-ide-3-carbonitrile |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.N#Cc1ccc2c(oc3c(-c4ccccn4)[c-]ccc32)c1-c1cccc(-c2ccc(-c3ccccc3)cc2)c1.[Ir] |
| InChI | InChI=1S/C36H21N2O.C12H10N.Ir/c37-23-29-19-20-31-30-12-7-13-32(33-14-4-5-21-38-33)35(30)39-36(31)34(29)28-11-6-10-27(22-28)26-17-15-25(16-18-26)24-8-2-1-3-9-24;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-12,14-22H;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | RZAAIOGKFXHYTN-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.01 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|