C39H28FIrN3O-2 — CID 168774915
5-tert-butyl-2-phenylpyridine;6-(5-fluoro-2-pyridinyl)-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium (PubChem CID 168774915) has the molecular formula C39H28FIrN3O-2 and a molecular weight of 765.89 g/mol. Its IUPAC name is 5-tert-butyl-2-phenylpyridine;6-(5-fluoro-2-pyridinyl)-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium.
| Compound Name | 5-tert-butyl-2-phenylpyridine;6-(5-fluoro-2-pyridinyl)-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium |
|---|---|
| PubChem CID | 168774915 |
| Molecular Formula | C39H28FIrN3O-2 |
| Molecular Weight | 765.89 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | 5-tert-butyl-2-phenylpyridine;6-(5-fluoro-2-pyridinyl)-4-phenyl-7H-dibenzofuran-7-ide-3-carbonitrile;iridium |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.N#Cc1ccc2c(oc3c(-c4ccc(F)cn4)[c-]ccc32)c1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C24H12FN2O.C15H16N.Ir/c25-17-10-12-21(27-14-17)20-8-4-7-18-19-11-9-16(13-26)22(24(19)28-23(18)20)15-5-2-1-3-6-15;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-7,9-12,14H;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | GCPZZGBXMGVTHF-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.89 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|