C42H38IrN2O-2 — CID 167357599
5-tert-butyl-2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium;2-(6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine (PubChem CID 167357599) has the molecular formula C42H38IrN2O-2 and a molecular weight of 779.00 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium;2-(6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine.
| Compound Name | 5-tert-butyl-2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium;2-(6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine |
|---|---|
| PubChem CID | 167357599 |
| Molecular Formula | C42H38IrN2O-2 |
| Molecular Weight | 779.00 g/mol |
| Exact Mass | 779.26 |
| IUPAC Name | 5-tert-butyl-2-(4-tert-butylbenzene-6-id-1-yl)pyridine;iridium;2-(6-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine |
| SMILES | CC(C)(C)c1c[c-]c(-c2ccc(C(C)(C)C)cn2)cc1.[Ir].[c-]1ccc2c(oc3c(-c4ccccc4)cccc32)c1-c1ccccn1 |
| InChI | InChI=1S/C23H14NO.C19H24N.Ir/c1-2-8-16(9-3-1)17-10-6-11-18-19-12-7-13-20(23(19)25-22(17)18)21-14-4-5-15-24-21;1-18(2,3)15-9-7-14(8-10-15)17-12-11-16(13-20-17)19(4,5)6;/h1-12,14-15H;7,9-13H,1-6H3;/q2*-1; |
| InChIKey | KYOCTFGISGETJC-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.00 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|