C38H38IrN2OSi-2 — CID 155608985
[6-(5-cyclohexyl-2-pyridinyl)-7H-dibenzofuran-7-id-2-yl]-trimethylsilane;iridium;2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 155608985) has the molecular formula C38H38IrN2OSi-2 and a molecular weight of 762.06 g/mol. Its IUPAC name is [6-(5-cyclohexyl-2-pyridinyl)-7H-dibenzofuran-7-id-2-yl]-trimethylsilane;iridium;2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | [6-(5-cyclohexyl-2-pyridinyl)-7H-dibenzofuran-7-id-2-yl]-trimethylsilane;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 155608985 |
| Molecular Formula | C38H38IrN2OSi-2 |
| Molecular Weight | 762.06 g/mol |
| Exact Mass | 762.26 |
| IUPAC Name | [6-(5-cyclohexyl-2-pyridinyl)-7H-dibenzofuran-7-id-2-yl]-trimethylsilane;iridium;2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | C[Si](C)(C)c1ccc2oc3c(-c4ccc(C5CCCCC5)cn4)[c-]ccc3c2c1.[2H]C([2H])([2H])c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C26H28NOSi.C12H10N.Ir/c1-29(2,3)20-13-15-25-23(16-20)21-10-7-11-22(26(21)28-25)24-14-12-19(17-27-24)18-8-5-4-6-9-18;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h7,10,12-18H,4-6,8-9H2,1-3H3;2-5,7-9H,1H3;/q2*-1;/i;1D3; |
| InChIKey | YZTQHTCDNMHALW-ICMJTWPQSA-N |
| XLogP | 9.90 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.06 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|